C19H17BrN4O6 — CID 163327459
N-[(4-bromophenyl)methyl]-1-methyl-5-(3-nitrophenyl)imidazol-2-amine;oxalic acid (PubChem CID 163327459) has the molecular formula C19H17BrN4O6 and a molecular weight of 477.27 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-1-methyl-5-(3-nitrophenyl)imidazol-2-amine;oxalic acid.
| Compound Name | N-[(4-bromophenyl)methyl]-1-methyl-5-(3-nitrophenyl)imidazol-2-amine;oxalic acid |
|---|---|
| PubChem CID | 163327459 |
| Molecular Formula | C19H17BrN4O6 |
| Molecular Weight | 477.27 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-1-methyl-5-(3-nitrophenyl)imidazol-2-amine;oxalic acid |
| SMILES | Cn1c(-c2cccc([N+](=O)[O-])c2)cnc1NCc1ccc(Br)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H15BrN4O2.C2H2O4/c1-21-16(13-3-2-4-15(9-13)22(23)24)11-20-17(21)19-10-12-5-7-14(18)8-6-12;3-1(4)2(5)6/h2-9,11H,10H2,1H3,(H,19,20);(H,3,4)(H,5,6) |
| InChIKey | FJTHPTBYBQKPKZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 147.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|