C19H25NO5Si — CID 170906723
5-(3-methoxyphenyl)-6-oxo-1-(2-trimethylsilylethoxymethyl)pyridine-3-carboxylic acid (PubChem CID 170906723) has the molecular formula C19H25NO5Si and a molecular weight of 375.50 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-6-oxo-1-(2-trimethylsilylethoxymethyl)pyridine-3-carboxylic acid.
| Compound Name | 5-(3-methoxyphenyl)-6-oxo-1-(2-trimethylsilylethoxymethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 170906723 |
| Molecular Formula | C19H25NO5Si |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 5-(3-methoxyphenyl)-6-oxo-1-(2-trimethylsilylethoxymethyl)pyridine-3-carboxylic acid |
| SMILES | COc1cccc(-c2cc(C(=O)O)cn(COCC[Si](C)(C)C)c2=O)c1 |
| InChI | InChI=1S/C19H25NO5Si/c1-24-16-7-5-6-14(10-16)17-11-15(19(22)23)12-20(18(17)21)13-25-8-9-26(2,3)4/h5-7,10-12H,8-9,13H2,1-4H3,(H,22,23) |
| InChIKey | GYKSHFFKEGIKDZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|