C18H22FNO4Si — CID 170906721
5-(3-fluorophenyl)-6-oxo-1-(2-trimethylsilylethoxymethyl)pyridine-3-carboxylic acid (PubChem CID 170906721) has the molecular formula C18H22FNO4Si and a molecular weight of 363.46 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-6-oxo-1-(2-trimethylsilylethoxymethyl)pyridine-3-carboxylic acid.
| Compound Name | 5-(3-fluorophenyl)-6-oxo-1-(2-trimethylsilylethoxymethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 170906721 |
| Molecular Formula | C18H22FNO4Si |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 5-(3-fluorophenyl)-6-oxo-1-(2-trimethylsilylethoxymethyl)pyridine-3-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1cc(C(=O)O)cc(-c2cccc(F)c2)c1=O |
| InChI | InChI=1S/C18H22FNO4Si/c1-25(2,3)8-7-24-12-20-11-14(18(22)23)10-16(17(20)21)13-5-4-6-15(19)9-13/h4-6,9-11H,7-8,12H2,1-3H3,(H,22,23) |
| InChIKey | LDBVWJAQCQNTOZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|