C20H24N2O3Si — CID 166022038
3-[1-(2-trimethylsilylethoxymethyl)indazol-7-yl]benzoic acid (PubChem CID 166022038) has the molecular formula C20H24N2O3Si and a molecular weight of 368.51 g/mol. Its IUPAC name is 3-[1-(2-trimethylsilylethoxymethyl)indazol-7-yl]benzoic acid.
| Compound Name | 3-[1-(2-trimethylsilylethoxymethyl)indazol-7-yl]benzoic acid |
|---|---|
| PubChem CID | 166022038 |
| Molecular Formula | C20H24N2O3Si |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 3-[1-(2-trimethylsilylethoxymethyl)indazol-7-yl]benzoic acid |
| SMILES | C[Si](C)(C)CCOCn1ncc2cccc(-c3cccc(C(=O)O)c3)c21 |
| InChI | InChI=1S/C20H24N2O3Si/c1-26(2,3)11-10-25-14-22-19-17(13-21-22)8-5-9-18(19)15-6-4-7-16(12-15)20(23)24/h4-9,12-13H,10-11,14H2,1-3H3,(H,23,24) |
| InChIKey | BFCDSDHMVDLBGN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|