C19H24N4O2Si — CID 171501872
N-[1-(2-trimethylsilylethoxymethyl)indazol-7-yl]pyridine-3-carboxamide (PubChem CID 171501872) has the molecular formula C19H24N4O2Si and a molecular weight of 368.51 g/mol. Its IUPAC name is N-[1-(2-trimethylsilylethoxymethyl)indazol-7-yl]pyridine-3-carboxamide.
| Compound Name | N-[1-(2-trimethylsilylethoxymethyl)indazol-7-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171501872 |
| Molecular Formula | C19H24N4O2Si |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-[1-(2-trimethylsilylethoxymethyl)indazol-7-yl]pyridine-3-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1ncc2cccc(NC(=O)c3cccnc3)c21 |
| InChI | InChI=1S/C19H24N4O2Si/c1-26(2,3)11-10-25-14-23-18-15(13-21-23)6-4-8-17(18)22-19(24)16-7-5-9-20-12-16/h4-9,12-13H,10-11,14H2,1-3H3,(H,22,24) |
| InChIKey | IIVNXWKOQQTVIM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|