C14H22FN3OSi — CID 175233264
6-fluoro-N-methyl-1-(2-trimethylsilylethoxymethyl)indazol-7-amine (PubChem CID 175233264) has the molecular formula C14H22FN3OSi and a molecular weight of 295.43 g/mol. Its IUPAC name is 6-fluoro-N-methyl-1-(2-trimethylsilylethoxymethyl)indazol-7-amine.
| Compound Name | 6-fluoro-N-methyl-1-(2-trimethylsilylethoxymethyl)indazol-7-amine |
|---|---|
| PubChem CID | 175233264 |
| Molecular Formula | C14H22FN3OSi |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 6-fluoro-N-methyl-1-(2-trimethylsilylethoxymethyl)indazol-7-amine |
| SMILES | CNc1c(F)ccc2cnn(COCC[Si](C)(C)C)c12 |
| InChI | InChI=1S/C14H22FN3OSi/c1-16-13-12(15)6-5-11-9-17-18(14(11)13)10-19-7-8-20(2,3)4/h5-6,9,16H,7-8,10H2,1-4H3 |
| InChIKey | BPPCYYTWXNHMLE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|