C14H21FN2O3Si — CID 163233761
5-fluoro-7-(hydroxymethyl)-1-(2-trimethylsilylethoxymethyl)indazol-6-ol (PubChem CID 163233761) has the molecular formula C14H21FN2O3Si and a molecular weight of 312.42 g/mol. Its IUPAC name is 5-fluoro-7-(hydroxymethyl)-1-(2-trimethylsilylethoxymethyl)indazol-6-ol.
| Compound Name | 5-fluoro-7-(hydroxymethyl)-1-(2-trimethylsilylethoxymethyl)indazol-6-ol |
|---|---|
| PubChem CID | 163233761 |
| Molecular Formula | C14H21FN2O3Si |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 5-fluoro-7-(hydroxymethyl)-1-(2-trimethylsilylethoxymethyl)indazol-6-ol |
| SMILES | C[Si](C)(C)CCOCn1ncc2cc(F)c(O)c(CO)c21 |
| InChI | InChI=1S/C14H21FN2O3Si/c1-21(2,3)5-4-20-9-17-13-10(7-16-17)6-12(15)14(19)11(13)8-18/h6-7,18-19H,4-5,8-9H2,1-3H3 |
| InChIKey | YSKCTKPCPNTQAF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|