C19H24F2N4OSi — CID 142420452
2-[[7-(difluoromethyl)-5-(2-methylpyrimidin-5-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 142420452) has the molecular formula C19H24F2N4OSi and a molecular weight of 390.51 g/mol. Its IUPAC name is 2-[[7-(difluoromethyl)-5-(2-methylpyrimidin-5-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[7-(difluoromethyl)-5-(2-methylpyrimidin-5-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 142420452 |
| Molecular Formula | C19H24F2N4OSi |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2-[[7-(difluoromethyl)-5-(2-methylpyrimidin-5-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1ncc(-c2cc(C(F)F)c3c(cnn3COCC[Si](C)(C)C)c2)cn1 |
| InChI | InChI=1S/C19H24F2N4OSi/c1-13-22-9-16(10-23-13)14-7-15-11-24-25(12-26-5-6-27(2,3)4)18(15)17(8-14)19(20)21/h7-11,19H,5-6,12H2,1-4H3 |
| InChIKey | VHEKRNPKKNUFMA-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|