C14H21BrN2OSi — CID 58181208
2-[(5-bromo-7-methylindazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 58181208) has the molecular formula C14H21BrN2OSi and a molecular weight of 341.33 g/mol. Its IUPAC name is 2-[(5-bromo-7-methylindazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(5-bromo-7-methylindazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 58181208 |
| Molecular Formula | C14H21BrN2OSi |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 2-[(5-bromo-7-methylindazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cc(Br)cc2cnn(COCC[Si](C)(C)C)c12 |
| InChI | InChI=1S/C14H21BrN2OSi/c1-11-7-13(15)8-12-9-16-17(14(11)12)10-18-5-6-19(2,3)4/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | QPKMLEWZAVUIDT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|