C14H24N4OSi — CID 178027402
(1R)-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-c]pyridin-7-yl]ethanamine (PubChem CID 178027402) has the molecular formula C14H24N4OSi and a molecular weight of 292.46 g/mol. Its IUPAC name is (1R)-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-c]pyridin-7-yl]ethanamine.
| Compound Name | (1R)-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-c]pyridin-7-yl]ethanamine |
|---|---|
| PubChem CID | 178027402 |
| Molecular Formula | C14H24N4OSi |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (1R)-1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-c]pyridin-7-yl]ethanamine |
| SMILES | C[C@@H](N)c1nccc2cnn(COCC[Si](C)(C)C)c12 |
| InChI | InChI=1S/C14H24N4OSi/c1-11(15)13-14-12(5-6-16-13)9-17-18(14)10-19-7-8-20(2,3)4/h5-6,9,11H,7-8,10,15H2,1-4H3/t11-/m1/s1 |
| InChIKey | KBHPWRLFYSYRDT-LLVKDONJSA-N |
| XLogP | 2.76 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|