C11H22N2O3Si — CID 140747707
[4-methoxy-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]methanol (PubChem CID 140747707) has the molecular formula C11H22N2O3Si and a molecular weight of 258.39 g/mol. Its IUPAC name is [4-methoxy-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]methanol.
| Compound Name | [4-methoxy-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]methanol |
|---|---|
| PubChem CID | 140747707 |
| Molecular Formula | C11H22N2O3Si |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | [4-methoxy-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]methanol |
| SMILES | COc1cnn(COCC[Si](C)(C)C)c1CO |
| InChI | InChI=1S/C11H22N2O3Si/c1-15-11-7-12-13(10(11)8-14)9-16-5-6-17(2,3)4/h7,14H,5-6,8-9H2,1-4H3 |
| InChIKey | VPDUQVCZTPKRNE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|