C12H21BrN2O4Si — CID 152639581
4-bromo-5-(2-hydroxyethoxy)-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one (PubChem CID 152639581) has the molecular formula C12H21BrN2O4Si and a molecular weight of 365.30 g/mol. Its IUPAC name is 4-bromo-5-(2-hydroxyethoxy)-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one.
| Compound Name | 4-bromo-5-(2-hydroxyethoxy)-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 152639581 |
| Molecular Formula | C12H21BrN2O4Si |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 4-bromo-5-(2-hydroxyethoxy)-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one |
| SMILES | C[Si](C)(C)CCOCn1ncc(OCCO)c(Br)c1=O |
| InChI | InChI=1S/C12H21BrN2O4Si/c1-20(2,3)7-6-18-9-15-12(17)11(13)10(8-14-15)19-5-4-16/h8,16H,4-7,9H2,1-3H3 |
| InChIKey | ZFGLUXBPVIPILH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|