C16H26F3N3O3Si — CID 151148174
5-[[(1S)-1-cyclopropyl-2-hydroxyethyl]amino]-4-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one (PubChem CID 151148174) has the molecular formula C16H26F3N3O3Si and a molecular weight of 393.48 g/mol. Its IUPAC name is 5-[[(1S)-1-cyclopropyl-2-hydroxyethyl]amino]-4-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one.
| Compound Name | 5-[[(1S)-1-cyclopropyl-2-hydroxyethyl]amino]-4-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 151148174 |
| Molecular Formula | C16H26F3N3O3Si |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 5-[[(1S)-1-cyclopropyl-2-hydroxyethyl]amino]-4-(trifluoromethyl)-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one |
| SMILES | C[Si](C)(C)CCOCn1ncc(N[C@H](CO)C2CC2)c(C(F)(F)F)c1=O |
| InChI | InChI=1S/C16H26F3N3O3Si/c1-26(2,3)7-6-25-10-22-15(24)14(16(17,18)19)12(8-20-22)21-13(9-23)11-4-5-11/h8,11,13,21,23H,4-7,9-10H2,1-3H3/t13-/m1/s1 |
| InChIKey | MXQMSLDAVSDEOK-CYBMUJFWSA-N |
| XLogP | 2.76 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|