C28H36N6O4Si — CID 155764873
N-(4-amino-3-hydroxy-4-oxo-1-phenylbutan-2-yl)-1-methyl-3-[1-(2-trimethylsilylethoxymethyl)indazol-7-yl]pyrazole-4-carboxamide (PubChem CID 155764873) has the molecular formula C28H36N6O4Si and a molecular weight of 548.72 g/mol. Its IUPAC name is N-(4-amino-3-hydroxy-4-oxo-1-phenylbutan-2-yl)-1-methyl-3-[1-(2-trimethylsilylethoxymethyl)indazol-7-yl]pyrazole-4-carboxamide.
| Compound Name | N-(4-amino-3-hydroxy-4-oxo-1-phenylbutan-2-yl)-1-methyl-3-[1-(2-trimethylsilylethoxymethyl)indazol-7-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 155764873 |
| Molecular Formula | C28H36N6O4Si |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | N-(4-amino-3-hydroxy-4-oxo-1-phenylbutan-2-yl)-1-methyl-3-[1-(2-trimethylsilylethoxymethyl)indazol-7-yl]pyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)NC(Cc2ccccc2)C(O)C(N)=O)c(-c2cccc3cnn(COCC[Si](C)(C)C)c23)n1 |
| InChI | InChI=1S/C28H36N6O4Si/c1-33-17-22(28(37)31-23(26(35)27(29)36)15-19-9-6-5-7-10-19)24(32-33)21-12-8-11-20-16-30-34(25(20)21)18-38-13-14-39(2,3)4/h5-12,16-17,23,26,35H,13-15,18H2,1-4H3,(H2,29,36)(H,31,37) |
| InChIKey | PCQNNNVWLKMFNL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 137.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|