C29H37NO7Si — CID 53350015
ethyl 4-methoxy-5-[4-[(4-methoxyphenyl)methoxy]phenyl]-2-oxo-1-(2-trimethylsilylethoxymethyl)pyridine-3-carboxylate (PubChem CID 53350015) has the molecular formula C29H37NO7Si and a molecular weight of 539.70 g/mol. Its IUPAC name is ethyl 4-methoxy-5-[4-[(4-methoxyphenyl)methoxy]phenyl]-2-oxo-1-(2-trimethylsilylethoxymethyl)pyridine-3-carboxylate.
| Compound Name | ethyl 4-methoxy-5-[4-[(4-methoxyphenyl)methoxy]phenyl]-2-oxo-1-(2-trimethylsilylethoxymethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 53350015 |
| Molecular Formula | C29H37NO7Si |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | ethyl 4-methoxy-5-[4-[(4-methoxyphenyl)methoxy]phenyl]-2-oxo-1-(2-trimethylsilylethoxymethyl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(OC)c(-c2ccc(OCc3ccc(OC)cc3)cc2)cn(COCC[Si](C)(C)C)c1=O |
| InChI | InChI=1S/C29H37NO7Si/c1-7-36-29(32)26-27(34-3)25(18-30(28(26)31)20-35-16-17-38(4,5)6)22-10-14-24(15-11-22)37-19-21-8-12-23(33-2)13-9-21/h8-15,18H,7,16-17,19-20H2,1-6H3 |
| InChIKey | XDPZTRVRZPFWLE-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 85.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.70 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|