C18H27BrN2O4Si — CID 140834477
ethyl 4-bromo-2,6-dimethyl-7-oxo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-3-carboxylate (PubChem CID 140834477) has the molecular formula C18H27BrN2O4Si and a molecular weight of 443.41 g/mol. Its IUPAC name is ethyl 4-bromo-2,6-dimethyl-7-oxo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-3-carboxylate.
| Compound Name | ethyl 4-bromo-2,6-dimethyl-7-oxo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 140834477 |
| Molecular Formula | C18H27BrN2O4Si |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | ethyl 4-bromo-2,6-dimethyl-7-oxo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(COCC[Si](C)(C)C)c2c(=O)n(C)cc(Br)c12 |
| InChI | InChI=1S/C18H27BrN2O4Si/c1-7-25-18(23)14-12(2)21(11-24-8-9-26(4,5)6)16-15(14)13(19)10-20(3)17(16)22/h10H,7-9,11H2,1-6H3 |
| InChIKey | OLRGQMUPFLDUPO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|