C21H30BrN3O4Si — CID 140834478
(1-cyano-2-methylpropan-2-yl) 4-bromo-2,6-dimethyl-7-oxo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-3-carboxylate (PubChem CID 140834478) has the molecular formula C21H30BrN3O4Si and a molecular weight of 496.48 g/mol. Its IUPAC name is (1-cyano-2-methylpropan-2-yl) 4-bromo-2,6-dimethyl-7-oxo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-3-carboxylate.
| Compound Name | (1-cyano-2-methylpropan-2-yl) 4-bromo-2,6-dimethyl-7-oxo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 140834478 |
| Molecular Formula | C21H30BrN3O4Si |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | (1-cyano-2-methylpropan-2-yl) 4-bromo-2,6-dimethyl-7-oxo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-3-carboxylate |
| SMILES | Cc1c(C(=O)OC(C)(C)CC#N)c2c(Br)cn(C)c(=O)c2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C21H30BrN3O4Si/c1-14-16(20(27)29-21(2,3)8-9-23)17-15(22)12-24(4)19(26)18(17)25(14)13-28-10-11-30(5,6)7/h12H,8,10-11,13H2,1-7H3 |
| InChIKey | MWMRKSAOEAFSHE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 86.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|