C20H26BrN3O2Si — CID 58506045
4-[3-[4-bromo-5-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-oxopropyl]benzonitrile (PubChem CID 58506045) has the molecular formula C20H26BrN3O2Si and a molecular weight of 448.44 g/mol. Its IUPAC name is 4-[3-[4-bromo-5-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-oxopropyl]benzonitrile.
| Compound Name | 4-[3-[4-bromo-5-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-oxopropyl]benzonitrile |
|---|---|
| PubChem CID | 58506045 |
| Molecular Formula | C20H26BrN3O2Si |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 4-[3-[4-bromo-5-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-oxopropyl]benzonitrile |
| SMILES | Cc1c(Br)nc(C(=O)CCc2ccc(C#N)cc2)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C20H26BrN3O2Si/c1-15-19(21)23-20(24(15)14-26-11-12-27(2,3)4)18(25)10-9-16-5-7-17(13-22)8-6-16/h5-8H,9-12,14H2,1-4H3 |
| InChIKey | LPJDOVNOGJEORU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|