C29H36N4O4Si — CID 58506201
ethyl 3-[5-methyl-2-(3-pyridin-4-ylpropanoyl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-7H-cyclopenta[b]pyridine-6-carboxylate (PubChem CID 58506201) has the molecular formula C29H36N4O4Si and a molecular weight of 532.72 g/mol. Its IUPAC name is ethyl 3-[5-methyl-2-(3-pyridin-4-ylpropanoyl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-7H-cyclopenta[b]pyridine-6-carboxylate.
| Compound Name | ethyl 3-[5-methyl-2-(3-pyridin-4-ylpropanoyl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-7H-cyclopenta[b]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 58506201 |
| Molecular Formula | C29H36N4O4Si |
| Molecular Weight | 532.72 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | ethyl 3-[5-methyl-2-(3-pyridin-4-ylpropanoyl)-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-7H-cyclopenta[b]pyridine-6-carboxylate |
| SMILES | CCOC(=O)C1=Cc2cc(-c3nc(C(=O)CCc4ccncc4)n(COCC[Si](C)(C)C)c3C)cnc2C1 |
| InChI | InChI=1S/C29H36N4O4Si/c1-6-37-29(35)23-15-22-16-24(18-31-25(22)17-23)27-20(2)33(19-36-13-14-38(3,4)5)28(32-27)26(34)8-7-21-9-11-30-12-10-21/h9-12,15-16,18H,6-8,13-14,17,19H2,1-5H3 |
| InChIKey | HUMZFTRVAOIFLW-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 96.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.72 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|