C18H26BrN3O2Si — CID 58506055
1-[4-bromo-5-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-pyridin-4-ylpropan-1-one (PubChem CID 58506055) has the molecular formula C18H26BrN3O2Si and a molecular weight of 424.42 g/mol. Its IUPAC name is 1-[4-bromo-5-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-pyridin-4-ylpropan-1-one.
| Compound Name | 1-[4-bromo-5-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-pyridin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 58506055 |
| Molecular Formula | C18H26BrN3O2Si |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 1-[4-bromo-5-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-pyridin-4-ylpropan-1-one |
| SMILES | Cc1c(Br)nc(C(=O)CCc2ccncc2)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C18H26BrN3O2Si/c1-14-17(19)21-18(22(14)13-24-11-12-25(2,3)4)16(23)6-5-15-7-9-20-10-8-15/h7-10H,5-6,11-13H2,1-4H3 |
| InChIKey | LPFFSVPMVLTSLQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|