C9H16BrN3O3Si — CID 175958107
5-bromo-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazole-3-carboxylic acid (PubChem CID 175958107) has the molecular formula C9H16BrN3O3Si and a molecular weight of 322.24 g/mol. Its IUPAC name is 5-bromo-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazole-3-carboxylic acid.
| Compound Name | 5-bromo-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazole-3-carboxylic acid |
|---|---|
| PubChem CID | 175958107 |
| Molecular Formula | C9H16BrN3O3Si |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 5-bromo-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazole-3-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1nc(C(=O)O)nc1Br |
| InChI | InChI=1S/C9H16BrN3O3Si/c1-17(2,3)5-4-16-6-13-9(10)11-7(12-13)8(14)15/h4-6H2,1-3H3,(H,14,15) |
| InChIKey | MRNGXIDIRFFWKK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|