C16H21BrN2O2Si — CID 157048343
[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]-phenylmethanone (PubChem CID 157048343) has the molecular formula C16H21BrN2O2Si and a molecular weight of 381.35 g/mol. Its IUPAC name is [3-bromo-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]-phenylmethanone.
| Compound Name | [3-bromo-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 157048343 |
| Molecular Formula | C16H21BrN2O2Si |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | [3-bromo-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]-phenylmethanone |
| SMILES | C[Si](C)(C)CCOCn1nc(Br)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H21BrN2O2Si/c1-22(2,3)10-9-21-12-19-14(11-15(17)18-19)16(20)13-7-5-4-6-8-13/h4-8,11H,9-10,12H2,1-3H3 |
| InChIKey | INJZIAZWGGVXHY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|