C26H39BrN6O5SSi2 — CID 154407206
3-bromo-N-[4-[pyrimidin-2-yl(2-trimethylsilylethoxymethyl)sulfamoyl]phenyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxamide (PubChem CID 154407206) has the molecular formula C26H39BrN6O5SSi2 and a molecular weight of 683.78 g/mol. Its IUPAC name is 3-bromo-N-[4-[pyrimidin-2-yl(2-trimethylsilylethoxymethyl)sulfamoyl]phenyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxamide.
| Compound Name | 3-bromo-N-[4-[pyrimidin-2-yl(2-trimethylsilylethoxymethyl)sulfamoyl]phenyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 154407206 |
| Molecular Formula | C26H39BrN6O5SSi2 |
| Molecular Weight | 683.78 g/mol |
| Exact Mass | 682.14 |
| IUPAC Name | 3-bromo-N-[4-[pyrimidin-2-yl(2-trimethylsilylethoxymethyl)sulfamoyl]phenyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxamide |
| SMILES | C[Si](C)(C)CCOCN(c1ncccn1)S(=O)(=O)c1ccc(NC(=O)c2cc(Br)nn2COCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C26H39BrN6O5SSi2/c1-40(2,3)16-14-37-19-32-23(18-24(27)31-32)25(34)30-21-8-10-22(11-9-21)39(35,36)33(26-28-12-7-13-29-26)20-38-15-17-41(4,5)6/h7-13,18H,14-17,19-20H2,1-6H3,(H,30,34) |
| InChIKey | FFBMWQSGZONCJM-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.78 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|