C14H21N3O2Si — CID 156716995
1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-yl]ethanone (PubChem CID 156716995) has the molecular formula C14H21N3O2Si and a molecular weight of 291.43 g/mol. Its IUPAC name is 1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-yl]ethanone.
| Compound Name | 1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-yl]ethanone |
|---|---|
| PubChem CID | 156716995 |
| Molecular Formula | C14H21N3O2Si |
| Molecular Weight | 291.43 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 1-[1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridin-3-yl]ethanone |
| SMILES | CC(=O)c1nn(COCC[Si](C)(C)C)c2ncccc12 |
| InChI | InChI=1S/C14H21N3O2Si/c1-11(18)13-12-6-5-7-15-14(12)17(16-13)10-19-8-9-20(2,3)4/h5-7H,8-10H2,1-4H3 |
| InChIKey | RJHTXBWMQCNPKV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|