C18H21ClN2O2Si — CID 21135820
7-chloro-10-(2-trimethylsilylethoxymethyl)benzo[b][1,8]naphthyridin-5-one (PubChem CID 21135820) has the molecular formula C18H21ClN2O2Si and a molecular weight of 360.92 g/mol. Its IUPAC name is 7-chloro-10-(2-trimethylsilylethoxymethyl)benzo[b][1,8]naphthyridin-5-one.
| Compound Name | 7-chloro-10-(2-trimethylsilylethoxymethyl)benzo[b][1,8]naphthyridin-5-one |
|---|---|
| PubChem CID | 21135820 |
| Molecular Formula | C18H21ClN2O2Si |
| Molecular Weight | 360.92 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 7-chloro-10-(2-trimethylsilylethoxymethyl)benzo[b][1,8]naphthyridin-5-one |
| SMILES | C[Si](C)(C)CCOCn1c2ccc(Cl)cc2c(=O)c2cccnc21 |
| InChI | InChI=1S/C18H21ClN2O2Si/c1-24(2,3)10-9-23-12-21-16-7-6-13(19)11-15(16)17(22)14-5-4-8-20-18(14)21/h4-8,11H,9-10,12H2,1-3H3 |
| InChIKey | IPPUYDAKMMYNBL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.92 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|