C19H15N3O2 — CID 132515576
10-[(4-methoxyphenyl)methyl]pyrido[2,3-b][1,8]naphthyridin-5-one (PubChem CID 132515576) has the molecular formula C19H15N3O2 and a molecular weight of 317.35 g/mol. Its IUPAC name is 10-[(4-methoxyphenyl)methyl]pyrido[2,3-b][1,8]naphthyridin-5-one.
| Compound Name | 10-[(4-methoxyphenyl)methyl]pyrido[2,3-b][1,8]naphthyridin-5-one |
|---|---|
| PubChem CID | 132515576 |
| Molecular Formula | C19H15N3O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 10-[(4-methoxyphenyl)methyl]pyrido[2,3-b][1,8]naphthyridin-5-one |
| SMILES | COc1ccc(Cn2c3ncccc3c(=O)c3cccnc32)cc1 |
| InChI | InChI=1S/C19H15N3O2/c1-24-14-8-6-13(7-9-14)12-22-18-15(4-2-10-20-18)17(23)16-5-3-11-21-19(16)22/h2-11H,12H2,1H3 |
| InChIKey | UMRFSADBFWASRB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|