C25H17NO4 — CID 118710593
6-[(4-methoxyphenyl)methyl]benzo[b]phenanthridine-5,7,12-trione (PubChem CID 118710593) has the molecular formula C25H17NO4 and a molecular weight of 395.41 g/mol. Its IUPAC name is 6-[(4-methoxyphenyl)methyl]benzo[b]phenanthridine-5,7,12-trione.
| Compound Name | 6-[(4-methoxyphenyl)methyl]benzo[b]phenanthridine-5,7,12-trione |
|---|---|
| PubChem CID | 118710593 |
| Molecular Formula | C25H17NO4 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 6-[(4-methoxyphenyl)methyl]benzo[b]phenanthridine-5,7,12-trione |
| SMILES | COc1ccc(Cn2c3c(c4ccccc4c2=O)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C25H17NO4/c1-30-16-12-10-15(11-13-16)14-26-22-21(17-6-2-5-9-20(17)25(26)29)23(27)18-7-3-4-8-19(18)24(22)28/h2-13H,14H2,1H3 |
| InChIKey | AWLHMENSACVHFE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|