C24H17NO3 — CID 12049959
5-benzyl-8-methoxybenzo[b]carbazole-6,11-dione (PubChem CID 12049959) has the molecular formula C24H17NO3 and a molecular weight of 367.40 g/mol. Its IUPAC name is 5-benzyl-8-methoxybenzo[b]carbazole-6,11-dione.
| Compound Name | 5-benzyl-8-methoxybenzo[b]carbazole-6,11-dione |
|---|---|
| PubChem CID | 12049959 |
| Molecular Formula | C24H17NO3 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 5-benzyl-8-methoxybenzo[b]carbazole-6,11-dione |
| SMILES | COc1ccc2c(c1)C(=O)c1c(c3ccccc3n1Cc1ccccc1)C2=O |
| InChI | InChI=1S/C24H17NO3/c1-28-16-11-12-17-19(13-16)24(27)22-21(23(17)26)18-9-5-6-10-20(18)25(22)14-15-7-3-2-4-8-15/h2-13H,14H2,1H3 |
| InChIKey | FGWDVSVTQNHKSK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|