C18H13NO3 — CID 122194430
8-methoxy-5-methylindeno[2,1-b]quinoline-6,11-dione (PubChem CID 122194430) has the molecular formula C18H13NO3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 8-methoxy-5-methylindeno[2,1-b]quinoline-6,11-dione.
| Compound Name | 8-methoxy-5-methylindeno[2,1-b]quinoline-6,11-dione |
|---|---|
| PubChem CID | 122194430 |
| Molecular Formula | C18H13NO3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 8-methoxy-5-methylindeno[2,1-b]quinoline-6,11-dione |
| SMILES | COc1ccc2c(c1)C(=O)c1c-2c(=O)c2ccccc2n1C |
| InChI | InChI=1S/C18H13NO3/c1-19-14-6-4-3-5-12(14)17(20)15-11-8-7-10(22-2)9-13(11)18(21)16(15)19/h3-9H,1-2H3 |
| InChIKey | ZTBYTLSPIBDFPZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |