C21H20BrNO2 — CID 91061389
6-(3-bromopropyl)indeno[1,2-c]isoquinoline-5,11-dione;ethane (PubChem CID 91061389) has the molecular formula C21H20BrNO2 and a molecular weight of 398.30 g/mol. Its IUPAC name is 6-(3-bromopropyl)indeno[1,2-c]isoquinoline-5,11-dione;ethane.
| Compound Name | 6-(3-bromopropyl)indeno[1,2-c]isoquinoline-5,11-dione;ethane |
|---|---|
| PubChem CID | 91061389 |
| Molecular Formula | C21H20BrNO2 |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 6-(3-bromopropyl)indeno[1,2-c]isoquinoline-5,11-dione;ethane |
| SMILES | CC.O=C1c2ccccc2-c2c1c1ccccc1c(=O)n2CCCBr |
| InChI | InChI=1S/C19H14BrNO2.C2H6/c20-10-5-11-21-17-13-7-2-3-8-14(13)18(22)16(17)12-6-1-4-9-15(12)19(21)23;1-2/h1-4,6-9H,5,10-11H2;1-2H3 |
| InChIKey | DFGSZPXYRVPBTA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|