C19H15N2O2V- — CID 59799530
2-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)ethyl-methylazanide;vanadium (PubChem CID 59799530) has the molecular formula C19H15N2O2V- and a molecular weight of 354.29 g/mol. Its IUPAC name is 2-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)ethyl-methylazanide;vanadium.
| Compound Name | 2-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)ethyl-methylazanide;vanadium |
|---|---|
| PubChem CID | 59799530 |
| Molecular Formula | C19H15N2O2V- |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 2-(5,11-dioxoindeno[1,2-c]isoquinolin-6-yl)ethyl-methylazanide;vanadium |
| SMILES | C[N-]CCn1c2c(c3ccccc3c1=O)C(=O)c1ccccc1-2.[V] |
| InChI | InChI=1S/C19H15N2O2.V/c1-20-10-11-21-17-13-7-3-4-8-14(13)18(22)16(17)12-6-2-5-9-15(12)19(21)23;/h2-9H,10-11H2,1H3;/q-1; |
| InChIKey | UROLDMXRFGIDAW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 53.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|