C24H25N3O3 — CID 127254868
6-[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]indeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 127254868) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 6-[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]indeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 6-[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]indeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 127254868 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 6-[2-hydroxy-3-(4-methylpiperazin-1-yl)propyl]indeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | CN1CCN(CC(O)Cn2c3c(c4ccccc4c2=O)C(=O)c2ccccc2-3)CC1 |
| InChI | InChI=1S/C24H25N3O3/c1-25-10-12-26(13-11-25)14-16(28)15-27-22-18-7-3-4-8-19(18)23(29)21(22)17-6-2-5-9-20(17)24(27)30/h2-9,16,28H,10-15H2,1H3 |
| InChIKey | CSXZHSSXWMPEIH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|