C20H17NO6S — CID 122179159
6-[(2S)-2,3-dihydroxypropyl]-3-methylsulfonylindeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 122179159) has the molecular formula C20H17NO6S and a molecular weight of 399.42 g/mol. Its IUPAC name is 6-[(2S)-2,3-dihydroxypropyl]-3-methylsulfonylindeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 6-[(2S)-2,3-dihydroxypropyl]-3-methylsulfonylindeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 122179159 |
| Molecular Formula | C20H17NO6S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 6-[(2S)-2,3-dihydroxypropyl]-3-methylsulfonylindeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | CS(=O)(=O)c1ccc2c3c(n(C[C@H](O)CO)c(=O)c2c1)-c1ccccc1C3=O |
| InChI | InChI=1S/C20H17NO6S/c1-28(26,27)12-6-7-13-16(8-12)20(25)21(9-11(23)10-22)18-14-4-2-3-5-15(14)19(24)17(13)18/h2-8,11,22-23H,9-10H2,1H3/t11-/m0/s1 |
| InChIKey | HZETZLGWWGUKEA-NSHDSACASA-N |
| XLogP | 0.97 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|