C26H21NO5 — CID 127253469
6-[2-hydroxy-3-(4-methoxyphenoxy)propyl]indeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 127253469) has the molecular formula C26H21NO5 and a molecular weight of 427.46 g/mol. Its IUPAC name is 6-[2-hydroxy-3-(4-methoxyphenoxy)propyl]indeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 6-[2-hydroxy-3-(4-methoxyphenoxy)propyl]indeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 127253469 |
| Molecular Formula | C26H21NO5 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 6-[2-hydroxy-3-(4-methoxyphenoxy)propyl]indeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | COc1ccc(OCC(O)Cn2c3c(c4ccccc4c2=O)C(=O)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C26H21NO5/c1-31-17-10-12-18(13-11-17)32-15-16(28)14-27-24-20-7-3-4-8-21(20)25(29)23(24)19-6-2-5-9-22(19)26(27)30/h2-13,16,28H,14-15H2,1H3 |
| InChIKey | DIHGLTSVRIVBGL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|