C24H20N2O3 — CID 127253290
6-[2-(dimethylamino)-2-(furan-2-yl)ethyl]indeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 127253290) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 6-[2-(dimethylamino)-2-(furan-2-yl)ethyl]indeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 6-[2-(dimethylamino)-2-(furan-2-yl)ethyl]indeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 127253290 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 6-[2-(dimethylamino)-2-(furan-2-yl)ethyl]indeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | CN(C)C(Cn1c2c(c3ccccc3c1=O)C(=O)c1ccccc1-2)c1ccco1 |
| InChI | InChI=1S/C24H20N2O3/c1-25(2)19(20-12-7-13-29-20)14-26-22-16-9-4-5-10-17(16)23(27)21(22)15-8-3-6-11-18(15)24(26)28/h3-13,19H,14H2,1-2H3 |
| InChIKey | NYEFLFLFSZNBRR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|