C21H15N3O2 — CID 127253238
6-[2-(1H-imidazol-5-yl)ethyl]indeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 127253238) has the molecular formula C21H15N3O2 and a molecular weight of 341.37 g/mol. Its IUPAC name is 6-[2-(1H-imidazol-5-yl)ethyl]indeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 6-[2-(1H-imidazol-5-yl)ethyl]indeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 127253238 |
| Molecular Formula | C21H15N3O2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 6-[2-(1H-imidazol-5-yl)ethyl]indeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | O=C1c2ccccc2-c2c1c1ccccc1c(=O)n2CCc1cnc[nH]1 |
| InChI | InChI=1S/C21H15N3O2/c25-20-16-7-3-2-6-15(16)19-18(20)14-5-1-4-8-17(14)21(26)24(19)10-9-13-11-22-12-23-13/h1-8,11-12H,9-10H2,(H,22,23) |
| InChIKey | ZDHJEHIXROCNAQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|