C14H18Cl2N2O2Si — CID 156800676
2,7-dichloro-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one (PubChem CID 156800676) has the molecular formula C14H18Cl2N2O2Si and a molecular weight of 345.30 g/mol. Its IUPAC name is 2,7-dichloro-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one.
| Compound Name | 2,7-dichloro-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 156800676 |
| Molecular Formula | C14H18Cl2N2O2Si |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 2,7-dichloro-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one |
| SMILES | C[Si](C)(C)CCOCn1c(Cl)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C14H18Cl2N2O2Si/c1-21(2,3)7-6-20-9-18-13(19)11-5-4-10(15)8-12(11)17-14(18)16/h4-5,8H,6-7,9H2,1-3H3 |
| InChIKey | YNRHTAYIPXEKNS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|