C21H23N3O2SSi — CID 153396856
2-thieno[2,3-c]pyridin-5-yl-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one (PubChem CID 153396856) has the molecular formula C21H23N3O2SSi and a molecular weight of 409.59 g/mol. Its IUPAC name is 2-thieno[2,3-c]pyridin-5-yl-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one.
| Compound Name | 2-thieno[2,3-c]pyridin-5-yl-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 153396856 |
| Molecular Formula | C21H23N3O2SSi |
| Molecular Weight | 409.59 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 2-thieno[2,3-c]pyridin-5-yl-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one |
| SMILES | C[Si](C)(C)CCOCn1c(-c2cc3ccsc3cn2)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H23N3O2SSi/c1-28(2,3)11-9-26-14-24-20(18-12-15-8-10-27-19(15)13-22-18)23-17-7-5-4-6-16(17)21(24)25/h4-8,10,12-13H,9,11,14H2,1-3H3 |
| InChIKey | HRMKUKQRWPNNRM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|