C23H26BrN3O2SSi — CID 153396776
6-bromo-8-ethyl-2-thieno[2,3-c]pyridin-5-yl-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one (PubChem CID 153396776) has the molecular formula C23H26BrN3O2SSi and a molecular weight of 516.54 g/mol. Its IUPAC name is 6-bromo-8-ethyl-2-thieno[2,3-c]pyridin-5-yl-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one.
| Compound Name | 6-bromo-8-ethyl-2-thieno[2,3-c]pyridin-5-yl-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 153396776 |
| Molecular Formula | C23H26BrN3O2SSi |
| Molecular Weight | 516.54 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | 6-bromo-8-ethyl-2-thieno[2,3-c]pyridin-5-yl-3-(2-trimethylsilylethoxymethyl)quinazolin-4-one |
| SMILES | CCc1cc(Br)cc2c(=O)n(COCC[Si](C)(C)C)c(-c3cc4ccsc4cn3)nc12 |
| InChI | InChI=1S/C23H26BrN3O2SSi/c1-5-15-10-17(24)12-18-21(15)26-22(19-11-16-6-8-30-20(16)13-25-19)27(23(18)28)14-29-7-9-31(2,3)4/h6,8,10-13H,5,7,9,14H2,1-4H3 |
| InChIKey | XTUUQAVKSOVLNR-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.54 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|