C16H24BrN3OSi — CID 140796375
2-[[2-(4-bromo-2-pyridinyl)-4,5-dimethylimidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 140796375) has the molecular formula C16H24BrN3OSi and a molecular weight of 382.38 g/mol. Its IUPAC name is 2-[[2-(4-bromo-2-pyridinyl)-4,5-dimethylimidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-(4-bromo-2-pyridinyl)-4,5-dimethylimidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 140796375 |
| Molecular Formula | C16H24BrN3OSi |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 2-[[2-(4-bromo-2-pyridinyl)-4,5-dimethylimidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1nc(-c2cc(Br)ccn2)n(COCC[Si](C)(C)C)c1C |
| InChI | InChI=1S/C16H24BrN3OSi/c1-12-13(2)20(11-21-8-9-22(3,4)5)16(19-12)15-10-14(17)6-7-18-15/h6-7,10H,8-9,11H2,1-5H3 |
| InChIKey | AGGCUOZTBJIBGA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|