C18H30BrN3O2Si — CID 142547745
2-[[4-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-2-yl]methoxy]-N,N-dimethylethanamine (PubChem CID 142547745) has the molecular formula C18H30BrN3O2Si and a molecular weight of 428.45 g/mol. Its IUPAC name is 2-[[4-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-2-yl]methoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[[4-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-2-yl]methoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 142547745 |
| Molecular Formula | C18H30BrN3O2Si |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 2-[[4-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-2-yl]methoxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOCc1cc2c(Br)ccnc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C18H30BrN3O2Si/c1-21(2)8-9-23-13-15-12-16-17(19)6-7-20-18(16)22(15)14-24-10-11-25(3,4)5/h6-7,12H,8-11,13-14H2,1-5H3 |
| InChIKey | KNMJPRALRQZWMB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|