C13H18ClIN2OSi — CID 174596817
2-[(2-chloro-3-iodopyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 174596817) has the molecular formula C13H18ClIN2OSi and a molecular weight of 408.74 g/mol. Its IUPAC name is 2-[(2-chloro-3-iodopyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(2-chloro-3-iodopyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 174596817 |
| Molecular Formula | C13H18ClIN2OSi |
| Molecular Weight | 408.74 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | 2-[(2-chloro-3-iodopyrrolo[2,3-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(Cl)c(I)c2cccnc21 |
| InChI | InChI=1S/C13H18ClIN2OSi/c1-19(2,3)8-7-18-9-17-12(14)11(15)10-5-4-6-16-13(10)17/h4-6H,7-9H2,1-3H3 |
| InChIKey | DKQIQQVOYIUBDA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.74 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|