C23H27IN4O2Si — CID 175809964
2-[2-[4-iodo-5-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-4-pyridinyl]-3H-isoindol-1-one (PubChem CID 175809964) has the molecular formula C23H27IN4O2Si and a molecular weight of 546.49 g/mol. Its IUPAC name is 2-[2-[4-iodo-5-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-4-pyridinyl]-3H-isoindol-1-one.
| Compound Name | 2-[2-[4-iodo-5-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-4-pyridinyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 175809964 |
| Molecular Formula | C23H27IN4O2Si |
| Molecular Weight | 546.49 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | 2-[2-[4-iodo-5-methyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-4-pyridinyl]-3H-isoindol-1-one |
| SMILES | Cc1c(I)nc(-c2cc(N3Cc4ccccc4C3=O)ccn2)n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C23H27IN4O2Si/c1-16-21(24)26-22(28(16)15-30-11-12-31(2,3)4)20-13-18(9-10-25-20)27-14-17-7-5-6-8-19(17)23(27)29/h5-10,13H,11-12,14-15H2,1-4H3 |
| InChIKey | YXYBNHKYKLUNJM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|