C20H25ClN2OSi — CID 157374933
2-[[6-chloro-2-(2-methylphenyl)pyrrolo[3,2-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 157374933) has the molecular formula C20H25ClN2OSi and a molecular weight of 372.97 g/mol. Its IUPAC name is 2-[[6-chloro-2-(2-methylphenyl)pyrrolo[3,2-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[6-chloro-2-(2-methylphenyl)pyrrolo[3,2-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 157374933 |
| Molecular Formula | C20H25ClN2OSi |
| Molecular Weight | 372.97 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2-[[6-chloro-2-(2-methylphenyl)pyrrolo[3,2-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1ccccc1-c1cc2cnc(Cl)cc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C20H25ClN2OSi/c1-15-7-5-6-8-17(15)19-11-16-13-22-20(21)12-18(16)23(19)14-24-9-10-25(2,3)4/h5-8,11-13H,9-10,14H2,1-4H3 |
| InChIKey | BKFFOHZYPHFRAW-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.97 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|