C18H21BrN2O3Si — CID 10764648
3-bromo-4-[1-(2-trimethylsilylethoxymethyl)indol-2-yl]pyrrole-2,5-dione (PubChem CID 10764648) has the molecular formula C18H21BrN2O3Si and a molecular weight of 421.37 g/mol. Its IUPAC name is 3-bromo-4-[1-(2-trimethylsilylethoxymethyl)indol-2-yl]pyrrole-2,5-dione.
| Compound Name | 3-bromo-4-[1-(2-trimethylsilylethoxymethyl)indol-2-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 10764648 |
| Molecular Formula | C18H21BrN2O3Si |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 3-bromo-4-[1-(2-trimethylsilylethoxymethyl)indol-2-yl]pyrrole-2,5-dione |
| SMILES | C[Si](C)(C)CCOCn1c(C2=C(Br)C(=O)NC2=O)cc2ccccc21 |
| InChI | InChI=1S/C18H21BrN2O3Si/c1-25(2,3)9-8-24-11-21-13-7-5-4-6-12(13)10-14(21)15-16(19)18(23)20-17(15)22/h4-7,10H,8-9,11H2,1-3H3,(H,20,22,23) |
| InChIKey | OEDSQEYOXASYMA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|