C27H31NO3SSi — CID 101064849
(8R)-8-phenylsulfanyl-6-[1-(2-trimethylsilylethoxymethyl)indol-2-yl]-2-oxabicyclo[2.2.2]oct-5-en-3-one (PubChem CID 101064849) has the molecular formula C27H31NO3SSi and a molecular weight of 477.70 g/mol. Its IUPAC name is (8R)-8-phenylsulfanyl-6-[1-(2-trimethylsilylethoxymethyl)indol-2-yl]-2-oxabicyclo[2.2.2]oct-5-en-3-one.
| Compound Name | (8R)-8-phenylsulfanyl-6-[1-(2-trimethylsilylethoxymethyl)indol-2-yl]-2-oxabicyclo[2.2.2]oct-5-en-3-one |
|---|---|
| PubChem CID | 101064849 |
| Molecular Formula | C27H31NO3SSi |
| Molecular Weight | 477.70 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | (8R)-8-phenylsulfanyl-6-[1-(2-trimethylsilylethoxymethyl)indol-2-yl]-2-oxabicyclo[2.2.2]oct-5-en-3-one |
| SMILES | C[Si](C)(C)CCOCn1c(C2=CC3C(=O)OC2C[C@H]3Sc2ccccc2)cc2ccccc21 |
| InChI | InChI=1S/C27H31NO3SSi/c1-33(2,3)14-13-30-18-28-23-12-8-7-9-19(23)15-24(28)21-16-22-26(17-25(21)31-27(22)29)32-20-10-5-4-6-11-20/h4-12,15-16,22,25-26H,13-14,17-18H2,1-3H3/t22?,25?,26-/m1/s1 |
| InChIKey | XSHUHOUWXWUVCS-TXDAUAKNSA-N |
| XLogP | 6.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.70 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|