C22H23ClN2O4Si — CID 10983096
2-methyl-1,3-dioxo-6-(2-trimethylsilylethoxymethyl)pyrrolo[3,4-c]carbazole-4-carbonyl chloride (PubChem CID 10983096) has the molecular formula C22H23ClN2O4Si and a molecular weight of 442.98 g/mol. Its IUPAC name is 2-methyl-1,3-dioxo-6-(2-trimethylsilylethoxymethyl)pyrrolo[3,4-c]carbazole-4-carbonyl chloride.
| Compound Name | 2-methyl-1,3-dioxo-6-(2-trimethylsilylethoxymethyl)pyrrolo[3,4-c]carbazole-4-carbonyl chloride |
|---|---|
| PubChem CID | 10983096 |
| Molecular Formula | C22H23ClN2O4Si |
| Molecular Weight | 442.98 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 2-methyl-1,3-dioxo-6-(2-trimethylsilylethoxymethyl)pyrrolo[3,4-c]carbazole-4-carbonyl chloride |
| SMILES | CN1C(=O)c2c(C(=O)Cl)cc3c(c2C1=O)c1ccccc1n3COCC[Si](C)(C)C |
| InChI | InChI=1S/C22H23ClN2O4Si/c1-24-21(27)18-14(20(23)26)11-16-17(19(18)22(24)28)13-7-5-6-8-15(13)25(16)12-29-9-10-30(2,3)4/h5-8,11H,9-10,12H2,1-4H3 |
| InChIKey | AOVGJBKVSLZWBJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.98 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|