C29H32BrNO2Si — CID 71497017
1-[4-[2-(2-bromo-4-methylphenyl)-1-(2-trimethylsilylethoxymethyl)indol-3-yl]phenyl]ethanone (PubChem CID 71497017) has the molecular formula C29H32BrNO2Si and a molecular weight of 534.57 g/mol. Its IUPAC name is 1-[4-[2-(2-bromo-4-methylphenyl)-1-(2-trimethylsilylethoxymethyl)indol-3-yl]phenyl]ethanone.
| Compound Name | 1-[4-[2-(2-bromo-4-methylphenyl)-1-(2-trimethylsilylethoxymethyl)indol-3-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 71497017 |
| Molecular Formula | C29H32BrNO2Si |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | 1-[4-[2-(2-bromo-4-methylphenyl)-1-(2-trimethylsilylethoxymethyl)indol-3-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(-c2c(-c3ccc(C)cc3Br)n(COCC[Si](C)(C)C)c3ccccc23)cc1 |
| InChI | InChI=1S/C29H32BrNO2Si/c1-20-10-15-24(26(30)18-20)29-28(23-13-11-22(12-14-23)21(2)32)25-8-6-7-9-27(25)31(29)19-33-16-17-34(3,4)5/h6-15,18H,16-17,19H2,1-5H3 |
| InChIKey | IVRBUACBHYSAME-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|