C27H24BrNO3 — CID 512927
2-[(3-bromo-2,4,5-triphenylpyrrol-1-yl)methoxy]ethyl acetate (PubChem CID 512927) has the molecular formula C27H24BrNO3 and a molecular weight of 490.40 g/mol. Its IUPAC name is 2-[(3-bromo-2,4,5-triphenylpyrrol-1-yl)methoxy]ethyl acetate.
| Compound Name | 2-[(3-bromo-2,4,5-triphenylpyrrol-1-yl)methoxy]ethyl acetate |
|---|---|
| PubChem CID | 512927 |
| Molecular Formula | C27H24BrNO3 |
| Molecular Weight | 490.40 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | 2-[(3-bromo-2,4,5-triphenylpyrrol-1-yl)methoxy]ethyl acetate |
| SMILES | CC(=O)OCCOCn1c(-c2ccccc2)c(Br)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C27H24BrNO3/c1-20(30)32-18-17-31-19-29-26(22-13-7-3-8-14-22)24(21-11-5-2-6-12-21)25(28)27(29)23-15-9-4-10-16-23/h2-16H,17-19H2,1H3 |
| InChIKey | KHZRVEBOYIAYON-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.40 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|