C25H21BrN2O2 — CID 20821454
2-[2-(2-bromophenyl)-4,5-diphenylimidazol-1-yl]ethyl acetate (PubChem CID 20821454) has the molecular formula C25H21BrN2O2 and a molecular weight of 461.36 g/mol. Its IUPAC name is 2-[2-(2-bromophenyl)-4,5-diphenylimidazol-1-yl]ethyl acetate.
| Compound Name | 2-[2-(2-bromophenyl)-4,5-diphenylimidazol-1-yl]ethyl acetate |
|---|---|
| PubChem CID | 20821454 |
| Molecular Formula | C25H21BrN2O2 |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 2-[2-(2-bromophenyl)-4,5-diphenylimidazol-1-yl]ethyl acetate |
| SMILES | CC(=O)OCCn1c(-c2ccccc2Br)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C25H21BrN2O2/c1-18(29)30-17-16-28-24(20-12-6-3-7-13-20)23(19-10-4-2-5-11-19)27-25(28)21-14-8-9-15-22(21)26/h2-15H,16-17H2,1H3 |
| InChIKey | WSAZJDTWBUHFOX-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |